Magnesium Acetate Tetrahydrate is an electrolyte supplement.
| Catalog Number | API0231834 |
| Alternative Name(s) | Magnesium acetate; 142-72-3; ACETIC ACID, MAGNESIUM SALT |
| Research Area | API |
| Molecular Formula | C4H6MgO4 |
| CAS# | 142-72-3 |
| Inchi | InChI=1S/2C2H4O2.Mg/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| Inchi Key | UEGPKNKPLBYCNK-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Mg+2] |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/magnesium-acetate-item-334.html |
Magnesium Acetate is the acetate salt form of magnesium. Magnesium is a divalent cation essential for a number of biochemical processes involved in nerve signaling, bone mineralization and muscle contractions. About 350 enzymes involved in glycolysis and the Krebs cycle, formation of cyclic-AMP and ATP, cellular signal transduction and protein and nucleic acid synthesis are dependent on magnesium.
| Catalog Number | API142723 |
| Alternative Name(s) | Magnesium diacetate ACETIC ACID, MAGNESIUM SALT Cromosan |
| Research Area | Other APIs |
| Molecular Formula | C4H6MgO4 |
| CAS# | 142-72-3 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Mg+2] |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/magnesium-acetate-item-12535.html |
