Emetine HCl
Emetine HCl is an alkaloid from the roots of the tropical plant Cephaelis ipecacuanha and active ingredient in ipecac. The compound is an inhibitor of protein synthesis and DNA replication.
| Trivial name | / |
| Catalog Number | CSN20849 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C29H41ClN2O4 |
| CAS# | 14198-59-5 |
| Purity | ≥98% |
| SMILES | COC1=CC2=C(C=C1OC)CCN[C@@H]2C[C@@H]3[C@@H](CC)CN4CCC5=CC(OC)=C(OC)C=C5[C@]4([H])C3.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/emetine-hcl.html |