NMS-873 10mM * 1mL in DMSO
NMS-873 is a potent and specific small molecule allosteric inhibitor of the ATPase VCP/p97 (IC50 ~0.03 uM), identified by a high-throughput screening.
| Trivial name | NMS-873 10mM * 1mL in DMSO |
| Catalog Number | A12377-10mM-D |
| Alternative Name(s) | Pyridine, 3-?[3-?(cyclopentylthio)?-?5-?[[[2-?methyl-?4'-?(methylsulfonyl)?[1,?1'-?biphenyl]?-?4-?yl]?oxy]?methyl]?-?4H-?1,?2,?4-?triazol-?4-?yl]?- |
| Molecular Formula | C27H28N4O3S2 |
| CAS# | 1418013-75-8 |
| SMILES | CC1=C(C=CC(=C1)OCC2=NN=C(N2C3=CN=CC=C3)SC4CCCC4)C5=CC=C(C=C5)S(=O)(=O)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/nms-873.html |
