MM-102
MLL1 inhibitor,high-affinity peptidomimetic Chromatin/Epigenetics|Histone Methyltransferase
| Catalog Number | B1582-2 |
| Research Area | Chromatin/Epigenetics|Histone Methyltransferase |
| Molecular Formula | C35H49F2N7O4 |
| CAS# | 1417329-24-8 |
| Purity | 99.44% |
| SMILES | CCC(CC)(C(=O)NC(CCCN=C(N)N)C(=O)NC1(CCCC1)C(=O)NC(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)NC(=O)C(C)C |
| Size | 2mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1582 |
