2-Naphthalenyl ester fluorosulfuric acid
2-Naphthalenyl ester fluorosulfuric acid is a diaryl fluorosulfate (diaryl-OSO2F). It can be synthesized with 99% yield from the reaction between phenol and sulfuryl fluoride in the presence of triethylamine. It undergoes Suzuki-Miyaura reaction with aryl boronic acid in the presence of Pd(OAc)2 and Et3N to afford the corresponding biaryl derivative.
Catalog Number | CBB1123651 |
Molecular Formula | C10H7FO3S |
CAS# | 141694-39-5 |
Inchi | 1S/C10H7FO3S/c11-15(12,13)14-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
Inchi Key | IJQQGAGYVGLLJL-UHFFFAOYSA-N |
SMILES | O=S(OC1=CC=C2C(C=CC=C2)=C1)(F)=O |
Size | Inquiry |
Supplier Page | https://www.amerigoscientific.com/2-naphthalenyl-ester-fluorosulfuric-acid-item-123651.html |