O-Propargyl-Puromycin
O-Propargyl-Puromycin (OP-puro) is an alkyne puroanalog, a potent inhibitor of protein synthesis . It is used to label nascent proteins in whole animals, allowing the visualization of protein synthesis patterns in large explants from tissues and organs.
| Trivial name | OP-puro |
| Catalog Number | E4666 |
| Molecular Formula | C25H24O6 |
| CAS# | 1416561-90-4 |
| SMILES | CC(=CCC1=C(OC2=C(C1=O)C(=CC3=C2C=CC(O3)(C)C)O)C4=C(C=C(C=C4)O)O)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/o-propargyl-puromycin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4666-O-Propargyl-Puromycin-chemical-structure.png |