Dronedarone D6 Fumarate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06569 |
| Alternative Name(s) | (2E)-but-2-enedtylamino)(²H6)propoxy]benzoyl}-1-benzofuran-5-yl)methanesulfonamide |
| Research Area | Labeled Dronedarone, intended for use as an internal standard for the quantification of Dronedarone by GC- or LC-mass spectrometry. |
| Molecular Formula | C35H42D6N2O9S |
| CAS# | 141626-36-0 (Unlabeled) (Freebase) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(/C=C/C(O)=O)=O.O=C(C1=CC=C(OC([2H])([2H])C([2H])([2H])C([2H])([2H])N(CCCC)CCCC)C=C1)C(C2=CC(N[S](C)(=O)=O)=CC=C2O3)=C3CCCC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06569.html |
| Additional Information | NULL |