Dronedarone
Dronedarone (SR33589) is a derivative of amiodarone which is classified as a Class III antiarrhythmic agent. It shows rate-dependent inhibition of the rapid Na+ current, inhibits α and β-adrenergic receptors like Class II agents, exhibits blockade of K+ outward currents as the main mechanism of action of Class III, and effectively block slow Ca2+ inward currents (Class IV).
| Trivial name | SR33589 |
| Catalog Number | S5787 |
| Molecular Formula | C25H20N6O3 |
| CAS# | 141626-36-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | C=CC(=O)NC1=CC=CC(=C1)C(=O)NC2=CC=C(NC(=O)C3=NC(=CC=C3)C4=CC=N[NH]4)C=C2 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/dronedarone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/dronedarone-chemical-structure-s5787.gif |
