Dronedarone Hydrochloride (Standard) | MedChemExpress (MCE)
Dronedarone (Hydrochloride) (Standard) is the analytical standard of Dronedarone (Hydrochloride). This product is intended for research and analytical applications. Dronedarone Hydrochloride is a non-iodinated amiodarone derivative that inhibits Na+, K+ and Ca2+ currents.
| Trivial name | Dronedarone Hydrochloride (Standard) |
| Catalog Number | HY-75839R |
| Research Area | Cardiovascular Disease |
| CAS# | 141625-93-6 |
| Purity | ≥98.0% |
| SMILES | CS(=O)(NC1=CC=C(OC(CCCC)=C2C(C3=CC=C(OCCCN(CCCC)CCCC)C=C3)=O)C2=C1)=O.[H]Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dronedarone-hydrochloride-standard.html |