Dronedarone HCl
Dronedarone HCl is a multichannel blocker targeting potassium channel, sodium channel and calcium channel, used as an antiarrhythmic drug for treatment of atrial fibrillation (AF).
| Trivial name | SR 33589 |
| Catalog Number | CSN10870 |
| Alternative Name(s) | SR 33589 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C31H45ClN2O5S |
| CAS# | 141625-93-6 |
| Purity | ≥99% |
| SMILES | CS(=O)(NC1=CC=C(OC(CCCC)=C2C(C3=CC=C(OCCCN(CCCC)CCCC)C=C3)=O)C2=C1)=O.[H]Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/dronedarone-hcl.html |