GSK256066 2,2,2-trifluoroacetic acid 50mg
GSK256066 is a selective PDE4B(equal affinity to isoforms A-D) inhibitor with IC50 of 3.2 pM, >380,000-fold selectivity versus PDE1/2/3/5/6 and >2500-fold selectivity against PDE4B versus PDE7.
| Trivial name | GSK256066 2,2,2-trifluoroacetic acid 50mg |
| Catalog Number | A15097-50 |
| Alternative Name(s) | 6-[3-(dimethylcarbamoyl)phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide;2,2,2-trifluoroacetic acid |
| Molecular Formula | C29H27F3N4O7S |
| CAS# | 1415560-64-3 |
| SMILES | CC1=C2C(=CC(=C1)S(=O)(=O)C3=CC=CC(=C3)C(=O)N(C)C)C(=C(C=N2)C(=O)N)NC4=CC(=CC=C4)OC.C(=O)(C(F)(F)F)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/gsk256066-2-2-2-trifluoroacetic-acid.html |
