Levosimendan 10mM * 1mL in DMSO
Levosimendan is a Ca2+ sensitizer that increases contractile force of the myocardium by enhancing the sensitivity of myofilaments to calcium without increasing intracellular calcium concentration.
Trivial name | Levosimendan 10mM * 1mL in DMSO |
Catalog Number | A11874-10mM-D |
Alternative Name(s) | Mesoxalonitrile (-)-{p-[(R)-1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl]phenyl}hydrazone |
Molecular Formula | C14H12N6O |
CAS# | 141505-33-1 |
SMILES | C[C@@H]1CC(=O)NN=C1C2=CC=C(C=C2)NN=C(C#N)C#N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/levosimendan.html |