ABT-751 10mM * 1mL in DMSO
ABT-751 is an antimitotic agent, inhibits microtubule polymerization, binds to β-tubulin on the colchine site; blocks cell cycle at G2M phase and induces apoptosis.
Trivial name | ABT-751 10mM * 1mL in DMSO |
Catalog Number | A10024-10mM-D |
Alternative Name(s) | N-[2-[(4-Hydroxyphenyl)amino]-3-pyr idinyl]-4-methoxybenzenesulfonamide |
Molecular Formula | C18H17N3O4S |
CAS# | 141430-65-1 |
SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=C(N=CC=C2)NC3=CC=C(C=C3)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/abt-751.html |