LY 293284 | MedChemExpress (MCE)
LY 293284 is a potent and selective 5-HT1A receptor agonist. LY 293284 results in a significant drop in core temperature and consumes more food in cholestasis rat induced by bile duct resection[1][2].
| Trivial name | LY 293284 |
| Catalog Number | HY-120396 |
| Research Area | Neurological Disease |
| CAS# | 141318-62-9 |
| Purity | ≥98.00% |
| SMILES | CC(C1=C2C3=C(C=C1)NC=C3C[C@@H](C2)N(CCC)CCC)=O |
| PubChem Chemical Structure ID | 132345 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ly-293284.html |