(Rac)-IBT6A
(Rac)-IBT6A (BTK inhibitor 1) is a racemate of IBT6A and an impurity of Ibrutinib, which is a Btk inhibitor (IC50=0.5 nM), and can be used in the synthesis of IBT6A Ibrutinib dimer and IBT6A adduct.
| Trivial name | BTK inhibitor 1 |
| Catalog Number | E2382 |
| Molecular Formula | C22H22N6O |
| CAS# | 1412418-47-3 |
| SMILES | NC1=C2C(=NC=N1)[N](N=C2C3=CC=C(OC4=CC=CC=C4)C=C3)C5CCCNC5 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/-rac--ibt6a.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e2382-rac-ibt6a-chemical-structure.gif |