Diisobutyl adipate
Diisobutyl adipate is a bis(2-methylpropyl) ester of adipic acid that is used as a plasticizer and a fatty acid in synthetic oils.
| Catalog Number | CDC10-0279 |
| Alternative Name(s) | Hexanedioic acid 1,6-bis(2-methylpropyl) ester, NSC 6343 |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C14H26O4 |
| CAS# | 141-04-8 |
| Purity | 99.0% |
| Inchi | 1S/C14H26O4/c1-11(2)9-17-13(15)7-5-6-8-14(16)18-10-12(3)4/h11-12H,5-10H2,1-4H3 |
| SMILES | CC(C)COC(=O)CCCCC(=O)OCC(C)C |
| EC Number | 205-450-3 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/diisobutyl-adipate-item-2361.html |