Benzo-15-crown-5 ether
Benzo-15-crown-5-ether (B15C5) is employed as a ligand in metal-catalyzed reactions to improve reactivity and selectivity by coordinating with metal cations. Additionally, it serves as a chelating agent for sodium and potassium ions.
| Trivial name | B15C5 |
| Catalog Number | E4593 |
| Molecular Formula | C19H26ClN7O |
| CAS# | 14098-44-3 |
| SMILES | CC(C)C(CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NC3=CC(=CC(=C3)N)Cl |
| Size | 5g |
| Supplier Page | http://www.selleckchem.com/products/benzo-15-crown-5-ether.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e4593-Benzo-15-crown-5-ether-chemical-structure.png |
