Benzo-18-crown-6-ether | MedChemExpress (MCE)
Benzo-18-crown-6-ether (B18C6) is an organic compound that can be used to prepare stable microcapsule responsive layers for further assembly into bilayer microcapsules. For example, 18-Crown-6-ether is used to prepare the response layer and is coated with a G-quadruplex cross-linked hydrogel layer stabilized by K+; when Mg2+ ions are present, 18-Crown-6-ether and K+ ions can respectively Dissociates and locks with the G-quadruplex cross-linked layer, thereby achieving switchable controlled release of the load[1].
Trivial name | Benzo-18-crown-6-ether |
Catalog Number | HY-W103245 |
Alternative Name(s) | B18C6 |
Research Area | Others |
CAS# | 14098-24-9 |
Purity | ≥98.0% |
SMILES | C1=CC=C2C(=C1)OCCOCCOCCOCCOCCO2 |
Size | 250 mg |
Supplier Page | https://www.medchemexpress.com/benzo-18-crown-6-ether.html |