Olopatadine HCl
Histamine blocker Neuroscience|Histamine Receptor
| Catalog Number | B1576-S |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C21H23NO3.HCl |
| CAS# | 140462-76-6 |
| Purity | 99.94% |
| SMILES | CN(C)CCC=C1C2=CC=CC=C2COC3=C1C=C(C=C3)CC(=O)O.Cl |
| Size | Evaluation Sample |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1576 |
