JTE-151 | MedChemExpress (MCE)
JTE-151 is a RORγ inhibitor, which can suppress overactive immune response through inhibition of RORγ related to the activation of Th17 cells, making JTE-151 possible to be used in autoimmune disease research[1].
| Trivial name | JTE-151 |
| Catalog Number | HY-155487 |
| Research Area | Neurological Disease; Inflammation/Immunology |
| CAS# | 1404380-58-0 |
| Purity | ≥98.00% |
| SMILES | ClC1=CC(C)=CC=C1NC(C[C@H](CCC(O)=O)C2=NOC([C@@H]3C[C@H](CC(C)(C)C)C3)=C2C4CC4)=O |
| PubChem Chemical Structure ID | 71127425 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jte-151.html |