PFI-1
PFI-1 is a highly selective BET (bromodomain-containing protein) inhibitor for BRD4 with IC50 of 0.22 μM and for BRD2 with IC50 of 98 nM in a cell-free assay.
| Trivial name | PF-6405761 |
| Catalog Number | CSN17164 |
| Alternative Name(s) | PF-6405761 |
| Research Area | Cancer |
| Molecular Formula | C16H17N3O4S |
| CAS# | 1403764-72-6 |
| Purity | ≥98% |
| SMILES | O=S(C1=CC=CC=C1OC)(NC2=CC3=C(NC(N(C)C3)=O)C=C2)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/pfi-1.html |