EPZ-6438 10mM * 1mL in DMSO
EPZ-6438 is a potent, selective, and orally bioavailable small-molecule inhibitor of EZH2 enzymatic activity. It induces apoptosis and differentiation specifically in SMARCB1-deleted MRT cells.
| Trivial name | EPZ-6438 10mM * 1mL in DMSO |
| Catalog Number | A12712-10mM-D |
| Alternative Name(s) | N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-5-(ethyl(tetrahydro-2H-pyran-4-yl)amino)-4-methyl-4'-(morpholinomethyl)-[1,1'-biphenyl]-3-carboxamide |
| Molecular Formula | C34H44N4O4 |
| CAS# | 1403254-99-8 |
| SMILES | CCN(C1CCOCC1)C2=CC(=CC(=C2C)C(=O)NCC3=C(C=C(NC3=O)C)C)C4=CC=C(C=C4)CN5CCOCC5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/epz-6438.html |
