Amoxapine
API Standard
| Catalog Number | CS-O-05678 |
| Alternative Name(s) | 9-aza]pentadca-(15),3,5,7,9,11,13-heptaene |
| Research Area | Amoxapine is the N-demethylated derivative of the antipsychotic agent LOXAPINE that works by blocking the reuptake of norepinephrine, serotonin, or both. It also blocks dopamine receptors. Amoxapine is a tricyclic antidepressant of the dibenzoxazepine cla |
| Molecular Formula | C17H1ClN3O |
| CAS# | 14028-44-5 |
| Purity | >98% |
| SMILES | ClC1=CC=C2C(C(N3CCNCC3)=NC(C=CC=C4)=C4O2)=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05678.html |
