TRV130 10mg
TRV130 is an opioid drug that is under evaluation in human clinical trials for the treatment of acute severe pain. TRV130 elicits robust G protein signaling, with potency and efficacy similar to morphine, but with far less ??-arrestin 2 recruitment and receptor internalization, it displays less adverse effects than morphine.
| Trivial name | TRV130 10mg |
| Catalog Number | A14337-10 |
| Alternative Name(s) | (R)-N-((3-methoxythiophen-2-yl)methyl)-2-(9-(pyridin-2-yl)-6-oxaspiro[4.5]decan-9-yl)ethanamine hydrochloride |
| Molecular Formula | C22H31ClN2O2S |
| CAS# | 1401028-24-7 |
| SMILES | COC1=C(SC=C1)CNCC[C@]2(CCOC3(C2)CCCC3)C4=CC=CC=N4 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/trv130.html |
