Tylosin
Tylosin is a macrolide antibiotic and a bacteriostatic feed additive used in veterinary medicine with a broad spectrum of activity against Gram-positive organisms and a limited range of Gram-negative organisms.
| Trivial name | Fradizine |
| Catalog Number | CSN12163 |
| Alternative Name(s) | Fradizine |
| Research Area | Infection |
| Molecular Formula | C46H77NO17 |
| CAS# | 1401-69-0 |
| Purity | ≥98% |
| SMILES | O=CC[C@@H](C[C@H]1C)[C@H](O[C@H]2[C@@H]([C@@H](N(C)C)[C@@H]([C@@H](C)O2)O[C@@H]3C[C@@]([C@H]([C@H](C)O3)O)(C)O)O)[C@@H](C)[C@H](O)CC(O[C@H](CC)[C@@H](CO[C@H]4[C@@H]([C@@H]([C@@H]([C@@H](C)O4)O)OC)OC)/C=C(C)/C=C/C1=O)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/tylosin.html |
