N-cis-Octadec-9Z-enoyl-L-homoserine lactone | MedChemExpress (MCE)
N-cis-octadec-9Z-enoyl-L-Homoserine lactone is a potent inhibitor of AhyI. AhyI (expressing acylhomoserine lactone) is responsible for the biosynthesis of autoinducer-1 (AI-1), commonly referred to as a quorum sensing (QS) signaling molecule, which plays an essential role in bacterial communication. N-cis-octadec-9Z-enoyl-L-Homoserine lactone is a competitive inhibitor of AI-1 biosynthesis[1].
| Trivial name | N-cis-Octadec-9Z-enoyl-L-homoserine lactone |
| Catalog Number | HY-145462 |
| Research Area | Infection |
| CAS# | 1400974-23-3 |
| Purity | ≥98.0% |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(N[C@H]1CCOC1=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n-cis-octadec-9z-enoyl-l-homoserine-lactone.html |