µ-Conotoxin BuIIIB | MedChemExpress (MCE)
μ-Conotoxin BuIIIB (Mu-Conotoxin BuIIIB) is a mammalian neuronal voltage-gated sodium channel (VGSC) blocker. μ-Conotoxin BuIIIB can be obtained from the venom of Cone snails and is a probe for ion channel function research. μ-Conotoxin BuIIIB can be used in the study of neurological diseases such as pain[1].
| Trivial name | µ-Conotoxin BuIIIB |
| Catalog Number | HY-P5862 |
| Alternative Name(s) | Mu-Conotoxin BuIIIB |
| Research Area | Neurological Disease |
| CAS# | 1400096-06-1 |
| Purity | ≥98.00% |
| SMILES | O=C([C@@H](N)C(C)C)NCC(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(NCC(N[C@H](C(NCC(N[C@H](C(N[C@H]1CC2=CNC3=CC=CC=C23)=O)CCCNC(N)=N)=O)=O)CSSC[C@H](NC4=O)C(N)=O)=O)=O)CCCNC(N)=N)=O)CCCCN)=O)=O)CC(N)=O)=O)CCCCN)=O)CSSC[C@@H]4NC5=O)=O)CSSC[C@H](NC1=O)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H]5CCCNC(N)=N)=O)CO)=O)CC6=CNC=N6)=O)CC(O)=O)=O)CCCNC(N)=N)=O)=O)CCCNC(N)=N)=O)CCC(O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/conotoxin-buiiib.html |