Metaflumizone (Standard) | MedChemExpress (MCE)
Metaflumizone (Standard) is the analytical standard of Metaflumizone. This product is intended for research and analytical applications. Metaflumizone is a semicarbazone insecticide, acts as a potent sodium channel blocker[1].
| Trivial name | Metaflumizone (Standard) |
| Catalog Number | HY-116448R |
| Alternative Name(s) | BAS-320I (Standard) |
| Research Area | Infection |
| CAS# | 139968-49-3 |
| Purity | ≥98.0% |
| SMILES | FC(F)(F)C1=CC(/C(CC2=CC=C(C=C2)C#N)=N\NC(NC3=CC=C(C=C3)OC(F)(F)F)=O)=CC=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/metaflumizone-standard.html |