Loratadine D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-57296 |
| Alternative Name(s) | 4yridin-11-ylidene-2,3,4,5,5-d5)-1-piperidinecarboxylic Acid Ethyl Ester; Claritin-d5; Sch-29851-d5; |
| Research Area | Labeled Loratadine, intended for use as an internal standard for the quantification of Loratadine by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H18D5ClN2O2 |
| CAS# | 1398065-63-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=CC=C2C(CCC3=CC=CN=C3/C2=C4CCN(C(OC([2H])([2H])C([2H])([2H])[2H])=O)CC4)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST57296.html |
| Additional Information | NULL |