Amphotericin B (Injectable/Oral)
Amphotericin B is a macrolide antibiotic used to treat potentially life-threatening fungal infections. It has a role as an antiprotozoal drug, a bacterial metabolite and an antiamoebic agent. It is a macrolide antibiotic, a polyene antibiotic and an antibiotic antifungal drug.
| Catalog Number | API1397893 |
| Alternative Name(s) | Amphotericin Amphotericine B Halizon |
| Research Area | Antibiotic APIs |
| Molecular Formula | C47H73NO17 |
| CAS# | 1397-89-3 |
| SMILES | CC1C=CC=CC=CC=CC=CC=CC=CC(CC2C(C(CC(O2)(CC(CC(C(CCC(CC(CC(=O)OC(C(C1O)C)C)O)O)O)O)O)O)O)C(=O)O)OC3C(C(C(C(O3)C)O)N)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/amphotericin-b-injectableoral-item-12442.html |