Amphotericin B 10mM * 1mL in DMSO

Amphotericin B is a polyene antifungal antibiotic from Streptomyces sp. Amphotericin B induces K+ leakage, which is separate from its lethal action, as was demonstrated in human erythrocytes and is due to the inhibitory effect on the Na+/K+ pump.

Price Not Available 10mM * 1mL in DMSO Amphotericin B 10mM * 1mL in DMSO Supplier Page
Trivial name Amphotericin B 10mM * 1mL in DMSO
Catalog Number A10073-10mM-D
Alternative Name(s) 33-[(3-Amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-Dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid
Molecular Formula C₄₇H₇₃NO₁₇
CAS# 1397-89-3
SMILES C[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O
Size 10mM * 1mL in DMSO
Supplier Page http://www.adooq.com/amphotericin-b.html