KPT-330 10mM * 1mL in DMSO
KPT-330 inhibitor of CRM1 (XPO1)-mediated nuclear export has selective anti-leukaemic activity in preclinical models of T-cell acute lymphoblastic leukaemia and acute myeloid leukaemia.
| Trivial name | KPT-330 10mM * 1mL in DMSO |
| Catalog Number | A12582-10mM-D |
| Alternative Name(s) | (Z)-3-(3-(3,5-bis(trifluoromethyl)phenyl)-1H-1,2,4-triazol-1-yl)-N'-(pyrazin-2-yl)acrylohydrazide |
| Molecular Formula | C17H11F6N7O |
| CAS# | 1393477-72-9 |
| SMILES | C1=CN=C(C=N1)NNC(=O)/C=CN2C=NC(=N2)C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/kpt-330.html |
