Tenofovir alafenamide hemifumarate
Tenofovir alafenamide (TAF, GS-7340) hemifumarate is a prodrug of tenofovir but results in significantly higher intracellular tenofovir concentrations and lower serum levels. Tenofovir alafenamide is a novel nucleotide reverse transcriptase inhibitor for the treatment of HIV-1 infection.
| Trivial name | TAF hemifumarate, GS-7340 hemifumarate |
| Catalog Number | S4427 |
| Molecular Formula | C46H62N12O14P2 |
| CAS# | 1392275-56-7 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)OC(=O)C(C)N[P](=O)(COC(C)C[N]1C=NC2=C(N)N=CN=C12)OC3=CC=CC=C3.CC(C)OC(=O)C(C)N[P](=O)(COC(C)C[N]4C=NC5=C(N)N=CN=C45)OC6=CC=CC=C6.OC(=O)\C=C\C(O)=O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/tenofovir-alafenamide-hemifumarate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4427-tenofovir-alafenamide-hemifumarate-chemical-structure.gif |