ZM-241385 50mg
ZM-241385 is a potent and highly selective Adenosine A2A-R antagonist, with a pA2 of 9.02 for Adenosine A2A-R in cardiac vasculature and selectivities of 1000, 91 and 500,000 over Adenosine A1-R, Adenosine A2B-R and Adenosine A3-R sites, respectively.
| Trivial name | ZM-241385 50mg |
| Catalog Number | A13517-50 |
| Alternative Name(s) | 4-(2-(7-Amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-ylamino)ethyl)phenol |
| Molecular Formula | C16H15N7O2 |
| CAS# | 139180-30-6 |
| SMILES | C1=COC(=C1)C2=NN3C(=NC(=NC3=N2)NCCC4=CC=C(C=C4)O)N |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/zm-241385.html |