CEP-37440
CEP-37440 is an effective and specific Dual FAK/ALK inhibitor with IC50s of 120 nM(ALK cellular in 75% human plasma) and 2.3 nM (FAK).
| Catalog Number | T2655 |
| Alternative Name(s) | CEP37440 |
| Research Area | Tyrosine Kinase/Adaptors|||Angiogenesis|||Cytoskeletal Signaling |
| Molecular Formula | C30H38ClN7O3 |
| CAS# | 1391712-60-9 |
| Purity | 99.01% |
| SMILES | CNC(=O)c1ccccc1Nc1nc(ncc1Cl)Nc1c(c2c(C[C@H](CCC2)N2CCN(CC2)CCO)cc1)OC |
| Size | 1 mg |
| Supplier Page | https://www.targetmol.com/compound/CEP-37440 |
| Additional Information | https://www.targetmol.com/datasheet/T2655 |
