Lys01 | MedChemExpress (MCE)
Lys01, a dimeric form of Chloroquine (HY-17589A), is an autophagy inhibitor. Lys01 inhibits cell viability of 1205Lu, c8161, LN229, HT-29 cells with IC50s of 3.6, 3.8, 7.9, 6.0 μM. Lys01 can be used for anticancer research[1].
| Trivial name | Lys01 |
| Catalog Number | HY-12855 |
| Research Area | Cancer |
| CAS# | 1391426-22-4 |
| Purity | ≥98.00% |
| SMILES | CN(CCNC1=CC=NC2=C1C=CC(Cl)=C2)CCNC3=CC=NC4=CC(Cl)=CC=C43 |
| PubChem Chemical Structure ID | 70673567 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lys01.html |