α-Cytidine | MedChemExpress (MCE)
α-Cytidine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1].
| Trivial name | α-Cytidine |
| Catalog Number | HY-W576440 |
| Research Area | Cancer |
| CAS# | 13913-16-1 |
| Purity | 98.68% |
| SMILES | O[C@H]1[C@@H](O)[C@@H](N2C(N=C(N)C=C2)=O)O[C@@H]1CO |
| PubChem Chemical Structure ID | 168266058 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-cytidine.html |