Zanamivir
API Standard
| Catalog Number | CS-O-30822 |
| Alternative Name(s) | 4-Guanidino-Neu5c2en |
| Research Area | Zanamivir is a sialic acid-analogue neuraminidase inhibitor with antiviral activity. Administered into the respiratory tract by aerosol inhalation, zanamivir selectively binds to and inhibits influenza A and B virus neuraminidase-mediated cleavage of sial |
| Molecular Formula | C12H20N4O7 |
| CAS# | 139110-80-8 |
| Purity | >98% |
| SMILES | CC(N[C@H]([C@H]1NC(N)=N)[C@](OC(C(O)=O)=C1)([H])[C@H](O)[C@H](O)CO)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30822.html |