Carbocysteine 13C3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06463 |
| Alternative Name(s) | (2S)-2-amino-3��C)propanoicacid;unlabelled: 638-23-3;S-Carboxymethyl-L-cysteine-13C3; (2R)-2-Amino-3-[(carboxymethyl)thio]propionic Acid-13C3; (R)-S-(Carboxymethyl)cysteine-13C3; (L)-2-Amino-3-(carboxymethylthio)propionic Acid-13C3; 3-[(Carboxymethyl)thio]-L-alanine-13C3; AHR 3053-13C3; Bronchokod-13C3; Carbocisteine-13C3; Carbocit-13C3; Carbocysteine-13C3; Chilvax-13C3; DF 1794Y-13C3; L-(Carboxymethyl)cysteine-13C3; LJ 206-13C3; Lisil-13C3; Lisomucil-13C3; Loviscol-13C3; Muciclar-13C3; Mucocis-13C3; Mucodyne-13C3; Mucofan-13C3; Mucolase-13C3; Mucolex-13C3; Mucopront-13C3; Mucosol-13C3; Mucotab-13C3; Mukinyl;-13C3 NSC 14156-13C3; PectDrill-13C3; Pectox-13C3; Pulmoclase-13C3; Reomucil-13C3; Rhinathiol-13C3; Rhinatiol-13C3; Rinatiol-13C3; S-(Carboxymethyl)-(R)-cysteine-13C3; S-Carboxylmethyl-L-cysteine-13C3; Siroxyl-13C3; Thiodril-13C3; Transb |
| Research Area | Labeled Carbocysteine, intended for use as an internal standard for the quantification of Carbocysteine by GC- or LC-mass spectrometry. |
| Molecular Formula | C2[13C]3H9NO4S |
| CAS# | 1391068-19-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@H]([13C](O)=O)CS[13CH2][13C](O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06463.html |
| Additional Information | NULL |