Teneligliptin D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03670 |
| Alternative Name(s) | Tenelia-d8;[(2S,4S)-4-[4-(3-Methyl-1-phenyl-1H-pyrazol-5-yl)-1-piperazinyl]-2-pyrrolidinyl]-3-thiazolidinylmethanone-d8; 3-[[(2S,4S)-4-[4-(3-Methyl-1-phenyl-1H-pyrazol-5-yl)-1-piperazinyl]-2-pyrrolidinylcarbonyl]thiazolidine-d8. |
| Research Area | Labeled Teneligliptin, intended for use as an internal standard for the quantification of Teneligliptin by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H22N6OSD8 |
| CAS# | 1391012-95-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=NN(C2=CC=CC=C2)C(N3C([2H])([2H])C([2H])([2H])N([C@H]4C[C@@H](C(N5CCSC5)=O)NC4)C([2H])([2H])C3([2H])[2H])=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03670.html |
| Additional Information | NULL |
