Disodium Edetate
A chelating agent that sequesters a variety of polyvalent cations such as CALCIUM. It is used in pharmaceutical manufacturing and as a food additive.
| Catalog Number | PIE-0392 |
| Alternative Name(s) | Edetate disodium EDTA disodium salt Disodium edetate Edta disodium |
| Research Area | Chelating Agents |
| Molecular Formula | C10H14N2Na2O8 |
| CAS# | 139-33-3 |
| SMILES | C(CN(CC(=O)O)CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].[Na+].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/disodium-edetate-item-12686.html |