Complement factor D-IN-1
Complement factor D-IN-1 is an effective and selective small-molecule reversible factor d inhibitor (IC50s: 0.006 and 0.05 μM in FD Thioesterolytic Fluorescent Assay and a MAC Deposition Assay, respectively).
| Catalog Number | T16898 |
| Research Area | Others |
| Molecular Formula | C21H19BrN6O3 |
| CAS# | 1386455-76-0 |
| SMILES | C(CN1C=2C(C(C(N)=O)=N1)=CC=CC2)(=O)N3[C@]4([C@](C4)(C[C@H]3C(NC=5N=C(Br)C=CC5)=O)[H])[H] |
| Size | 1 mL |
| Supplier Page | https://www.targetmol.com/compound/ComplementfactorD-IN-1 |
| Additional Information | https://www.targetmol.com/datasheet/T16898 |