Paxalisib | MedChemExpress (MCE)
Paxalisib (GDC-0084) is a brain penetrant inhibitor of PI3K and mTOR, with Kis of 2 nM, 46 nM, 3 nM, 10 nM and 70 nM for PI3Kα PI3Kβ, PI3Kδ, PI3Kγ and mTOR, respectively[1].
| Trivial name | Paxalisib |
| Catalog Number | HY-19962 |
| Alternative Name(s) | GDC-0084 |
| CAS# | 1382979-44-3 |
| Purity | 99.7% |
| SMILES | NC1=NC=C(C2=NC(N3CCOCC3)=C4N=C(C(C)(C)OCC5)N5C4=N2)C=N1 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/GDC-0084.html |