Levofloxacin hydrate
Levofloxacin (Levaquin, Tavanic, Quixin, Iquix, Cravit) is a broad-spectrum, third-generation fluoroquinolone antibiotic and optically active L-isomer of ofloxacin with antibacterial activity. It acts by inhibiting DNA gyrase (bacterial topoisomerase II).
| Trivial name | Levofloxacin hemihydrate, Levaquin hydrate, Tavanic hydrate, Quixin hydrate, Iquix hydrate, Cravit hydrate |
| Catalog Number | S4604 |
| Molecular Formula | C17H18N4O3S |
| CAS# | 138199-71-0 |
| Inchi | InChI=1S/C17H18N4O3S/c18-16-15(14(22)11-3-1-2-4-13(11)21(23)24)25-17(20-16)19-12-8-9-5-6-10(12)7-9/h1-4,9-10,12H,5-8,18H2,(H,19,20)/t9?,10?,12-/m0/s1 |
| Inchi Key | JRNXAQINDCOHGS-CBINBANVSA-N |
| SMILES | C1CC2CC1CC2NC3=NC(=C(S3)C(=O)C4=CC=CC=C4[N+](=O)[O-])N |
| Size | 20mg |
| Supplier Page | http://www.selleckchem.com/products/levofloxacin-hydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/levofloxacin-hydrate-chemical-structure-s4604.gif |
