Levofloxacin Hemihydrate
Levofloxacin Hemihydrate is antibiotic against gram-negative organisms, working by inhibiting the supercoiling activity of bacterial DNA gyrase, halting DNA replication.
| Trivial name | Levofloxacin hemihydrate; Levaquin hydrate; Tavanic hydrate; Quixin hydrate; Iquix hydrate; Cravit hydrate |
| Catalog Number | CSN17036 |
| Alternative Name(s) | Levofloxacin hemihydrate; Levaquin hydrate; Tavanic hydrate; Quixin hydrate; Iquix hydrate; Cravit hydrate |
| Research Area | Infection |
| Molecular Formula | C36H42F2N6O9 |
| CAS# | 138199-71-0 |
| Purity | ≥99% |
| SMILES | O=C(C(C1=O)=CN2[C@@H](C)COC3=C(N4CCN(C)CC4)C(F)=CC1=C23)O.[H]O[H].O=C(C(C5=O)=CN6[C@@H](C)COC7=C(N8CCN(C)CC8)C(F)=CC5=C67)O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/levofloxacin-hemihydrate.html |
