Z-VRPR-FMK | MedChemExpress (MCE)
Z-VRPR-FMK is an irreversible MALT1 protein inhibitor. Z-VRPR-FMK inhibits the growth and invasion of diffuse large B-cell lymphoma by inhibiting MALT1-induced NF-κB activation and MMP expression[1].
| Trivial name | Z-VRPR-FMK |
| Catalog Number | HY-120231 |
| Research Area | Cancer |
| CAS# | 1381885-28-4 |
| Purity | ≥98.00% |
| SMILES | O=C(OCC1=CC=CC=C1)N[C@@H](C(C)C)C(N[C@@H](CCCNC(N)=N)C(N2[C@@H](CCC2)C(N[C@H](C(CF)=O)CCCNC(N)=N)=O)=O)=O |
| PubChem Chemical Structure ID | 99648010 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/z-vrpr-fmk.html |