Diethyl D-(-)-tartrate | MedChemExpress (MCE)
Diethyl D-(-)-tartrate (D-(-)-Tartaric acid diethyl ester) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].
| Trivial name | Diethyl D-(-)-tartrate |
| Catalog Number | HY-Y1361 |
| Alternative Name(s) | D-(-)-Tartaric acid diethyl ester |
| Research Area | Others |
| CAS# | 13811-71-7 |
| Purity | ≥98.0% |
| SMILES | CCOC([C@@H](O)[C@H](O)C(OCC)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/diethyl-d-minus-tartrate.html |