Deferoxamine Mesylate
Deferoxamine mesylate as a chelating agent used to remove excess iron from the body, treat acute iron poisoning, especially in small children, used to treat hemochromatosis, that can be either genetic or acquired.
| Trivial name | Desferrioxamine B Mesylate; DFOM |
| Catalog Number | CSN12565 |
| Alternative Name(s) | Desferrioxamine B Mesylate; DFOM |
| Research Area | / |
| Molecular Formula | C26H52N6O11S |
| CAS# | 138-14-7 |
| Purity | ≥99% |
| SMILES | O=C(N(CCCCCN)O)CCC(NCCCCCN(O)C(CCC(NCCCCCN(O)C(C)=O)=O)=O)=O.CS(=O)(O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/deferoxamine-mesylate.html |