SR9011
REV-ERB-α/β agonist Others|Nuclear Receptors
| Catalog Number | B1768-50 |
| Research Area | Others|Nuclear Receptors |
| Molecular Formula | C23H31ClN4O3S |
| CAS# | 1379686-29-9 |
| Purity | 99.27% |
| SMILES | CCCCCNC(N1CCC(C1)CN(CC(S2)=CC=C2[N+]([O-])=O)CC3=CC=C(Cl)C=C3)=O |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1768 |
