Zifaxaban | MedChemExpress (MCE)
Zifaxaban is an orally active, competitively and selective Factor Xa (FXa) inhibitor with an IC50 of 11.1 nM for human FXa. Zifaxaban shows >10000-fold greater selectivity than other serine proteases. Zifaxaban can be used for the arterial and venous thrombosis research[1].
| Trivial name | Zifaxaban |
| Catalog Number | HY-122592 |
| Research Area | Cardiovascular Disease |
| CAS# | 1378266-98-8 |
| Purity | ≥98.00% |
| SMILES | O=C(C1=CC=C(Cl)S1)NC[C@H]2CN(C3=CC=C(N4C=CC=CC4=O)C=C3)C(O2)=O |
| PubChem Chemical Structure ID | 60172452 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zifaxaban.html |